is , while it's Molecular Formula is C15H19N3O6. γ-Glutamyl donor substrate used in spectrophotometric determination of transglutaminase (TGase) activity. Z-Gln-Gly was used to enzymatically synthesize N-linked neoglycoproteins.

What is the CAS number for ?

The CAS number of is 6610-42-0.

What is (6610-42-0) used for?

InChI:InChI=1/C15H19N3O6/c16-12(19)7-6-11(14(22)17-8-13(20)21)18-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H2,16,19)(H,17,22)(H,18,23)(H,20,21)

is , while it's Molecular Formula is C15H19N3O6. γ-Glutamyl donor substrate used in spectrophotometric determination of transglutaminase (TGase) activity. Z-Gln-Gly was used to enzymatically synthesize N-linked neoglycoproteins.